7G4P
Crystal Structure of rat Autotaxin in complex with rac-(E)-1-[rac-(3aR,8aS)-2-(1H-benzotriazole-5-carbonyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one, i.e. SMILES N1(CC[C@@H]2[C@H](CC1)CN(C2)C(=O)c1ccc2c(c1)N=NN2)C(=O)/C=C/c1ccc(cc1)OC(F)(F)F with IC50=0.00155284 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2012-05-05 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 0.999970 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 84.786, 93.362, 120.964 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 46.720 - 2.120 |
| R-factor | 0.2204 |
| Rwork | 0.218 |
| R-free | 0.25840 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.007 |
| RMSD bond angle | 1.158 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.7.0025) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 46.680 | 46.720 | 2.180 |
| High resolution limit [Å] | 2.120 | 9.480 | 2.120 |
| Rmerge | 0.120 | 0.032 | 1.783 |
| Rmeas | 0.130 | 0.035 | 1.933 |
| Total number of observations | 362018 | ||
| Number of reflections | 55073 | 710 | 3997 |
| <I/σ(I)> | 11.1 | 37.08 | 1.21 |
| Completeness [%] | 99.7 | 98.3 | 99.3 |
| Redundancy | 6.573 | 5.786 | 6.688 |
| CC(1/2) | 0.998 | 0.999 | 0.546 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.5 | 293 | 15.3 mg/mL protein in 20mM BICINE/NaOH pH8.5, 150mM NaCl, 0.02% NaN3 mixed 50-70% with 50-30% reservoir consisting of 11-17% PEG3350, 0.1M Na-acetate pH4.5, 0.2M Ca-acetate, total volume 200nL |






