7G2J
Crystal Structure of rat Autotaxin in complex with 2-chloro-5-(5-cyclopropyloxy-2-fluorophenyl)-4-(1H-pyrazolo[3,4-b]pyridin-3-ylmethoxy)benzonitrile, i.e. SMILES C1C(C1)Oc1ccc(F)c(c1)c1cc(C#N)c(Cl)cc1OCC1=NNc2ncccc12 with IC50=0.0201566 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2015-12-29 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 0.999970 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 84.275, 91.714, 119.828 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 45.860 - 1.930 |
| R-factor | 0.1836 |
| Rwork | 0.182 |
| R-free | 0.22100 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.015 |
| RMSD bond angle | 1.694 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.8.0103) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 45.860 | 45.860 | 1.980 |
| High resolution limit [Å] | 1.930 | 8.630 | 1.930 |
| Rmerge | 0.132 | 0.039 | 1.762 |
| Rmeas | 0.144 | 0.042 | 1.906 |
| Total number of observations | 472911 | ||
| Number of reflections | 70528 | 904 | 5172 |
| <I/σ(I)> | 10.64 | 38.99 | 1.15 |
| Completeness [%] | 100.0 | 98.9 | 99.9 |
| Redundancy | 6.705 | 5.761 | 6.901 |
| CC(1/2) | 0.998 | 0.998 | 0.417 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.5 | 293 | 15.3 mg/mL protein in 20mM BICINE/NaOH pH8.5, 150mM NaCl, 0.02% NaN3 mixed 50-70% with 50-30% reservoir consisting of 11-17% PEG3350, 0.1M Na-acetate pH4.5, 0.2M Ca-acetate, total volume 200nL |






