7G0O
Crystal Structure of human FABP4 binding site mutated to that of FABP5 in complex with 2-[[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,5-dimethylthiophen-2-yl]carbamoyl]cyclohexene-1-carboxylic acid, i.e. SMILES C1(=C(CCCC1)C(=O)NC1=C(C(=C(C)S1)C)C1=NC(=NO1)C1CC1)C(=O)O with IC50=0.0950978 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2012-08-21 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 0.700030 |
| Spacegroup name | P 2 21 21 |
| Unit cell lengths | 32.115, 52.750, 72.365 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 42.630 - 1.320 |
| R-factor | 0.1738 |
| Rwork | 0.171 |
| R-free | 0.22950 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.015 |
| RMSD bond angle | 1.843 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.7.0029) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 42.630 | 42.630 | 1.350 |
| High resolution limit [Å] | 1.320 | 5.900 | 1.320 |
| Rmerge | 0.116 | 0.038 | 1.696 |
| Rmeas | 0.148 | 0.042 | 1.846 |
| Total number of observations | 186657 | ||
| Number of reflections | 29694 | 402 | 2134 |
| <I/σ(I)> | 7.58 | 31.41 | 1.07 |
| Completeness [%] | 100.0 | 98.5 | 99.9 |
| Redundancy | 6.36 | 5.692 | 6.382 |
| CC(1/2) | 0.997 | 0.999 | 0.304 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 7 | 293 | protein in 25mM Tris/HCl pH 7.5 100mM NaCl, see also PMID 27658368 |






