7FZC
Crystal Structure of human FABP4 in complex with 5-[(2-chlorophenoxy)methyl]-4-propan-2-yl-1,2,4-triazole-3-thiol, i.e. SMILES N1(C(=NN=C1COc1c(Cl)cccc1)S)C(C)C with IC50=0.249 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2011-10-22 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 1.000000 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 32.414, 53.807, 75.106 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 37.560 - 1.120 |
| R-factor | 0.1385 |
| Rwork | 0.137 |
| R-free | 0.16620 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.021 |
| RMSD bond angle | 2.110 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.6.0119) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 37.550 | 37.560 | 1.150 |
| High resolution limit [Å] | 1.120 | 5.020 | 1.120 |
| Rmerge | 0.038 | 0.021 | 0.275 |
| Rmeas | 0.040 | 0.023 | 0.308 |
| Total number of observations | 310381 | ||
| Number of reflections | 50408 | 675 | 3223 |
| <I/σ(I)> | 20.87 | 55.52 | 5.09 |
| Completeness [%] | 98.6 | 99.3 | 87 |
| Redundancy | 6.11 | 6.252 | 4.781 |
| CC(1/2) | 0.999 | 0.999 | 0.945 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 7 | 293 | protein in 25mM Tris/HCl pH 7.5 100mM NaCl, see also PMID 27658368 |






