7FYV
Crystal Structure of human FABP4 in complex with 5-(4-chlorophenyl)-9-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene-8-carboxylic acid, i.e. SMILES [C@H]12[C@H]3[C@@H]([C@@H]([C@@H]([C@H]1ON=C2c1ccc(cc1)Cl)C3)C)C(=O)O with IC50=5.6 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2011-12-11 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 0.700030 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 32.515, 53.939, 75.133 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 43.810 - 0.970 |
| R-factor | 0.1375 |
| Rwork | 0.136 |
| R-free | 0.16140 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.029 |
| RMSD bond angle | 2.480 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.6.0119) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 43.820 | 43.810 | 1.000 |
| High resolution limit [Å] | 0.970 | 4.340 | 0.970 |
| Rmerge | 0.039 | 0.015 | 1.492 |
| Rmeas | 0.042 | 0.017 | 1.620 |
| Total number of observations | 515101 | ||
| Number of reflections | 78999 | 1025 | 5756 |
| <I/σ(I)> | 15.99 | 80.64 | 1.15 |
| Completeness [%] | 99.9 | 99.4 | 99.5 |
| Redundancy | 6.52 | 6.06 | 6.517 |
| CC(1/2) | 1.000 | 1.000 | 0.532 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 7 | 293 | protein in 25mM Tris/HCl pH 7.5 100mM NaCl, see also PMID 27658368 |






