7FXY
Crystal Structure of human FABP4 in complex with (4-chlorophenyl)methyl 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate, i.e. SMILES C1(=C(C(=O)NC(=O)N1)F)C(=O)OCc1ccc(cc1)Cl with IC50=1.9 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2011-12-08 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 1.000020 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 32.535, 53.795, 74.775 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 37.400 - 1.130 |
| R-factor | 0.1476 |
| Rwork | 0.146 |
| R-free | 0.17420 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.022 |
| RMSD bond angle | 2.195 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.6.0119) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 37.390 | 37.400 | 1.160 |
| High resolution limit [Å] | 1.130 | 5.050 | 1.130 |
| Rmerge | 0.055 | 0.037 | 0.467 |
| Rmeas | 0.060 | 0.041 | 0.517 |
| Total number of observations | 305461 | ||
| Number of reflections | 49963 | 661 | 3654 |
| <I/σ(I)> | 14.86 | 36.6 | 4.28 |
| Completeness [%] | 99.8 | 98.5 | 99.8 |
| Redundancy | 6.15 | 6.112 | 5.443 |
| CC(1/2) | 0.998 | 0.997 | 0.908 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 7 | 293 | protein in 25mM Tris/HCl pH 7.5 100mM NaCl, see also PMID 27658368 |






