7FZV
Crystal Structure of human FABP4 in complex with 1-[(2,4-dichlorophenyl)methyl]-4-hydroxy-3-[(E)-3-phenylprop-2-enyl]pyridin-2-one, i.e. SMILES C1(=C(C=CN(C1=O)Cc1c(cc(cc1)Cl)Cl)O)C/C=C/c1ccccc1 with IC50=0.557 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2010-09-15 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 0.999900 |
| Spacegroup name | P 4 3 2 |
| Unit cell lengths | 137.496, 137.496, 137.496 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 45.830 - 2.550 |
| R-factor | 0.1983 |
| Rwork | 0.195 |
| R-free | 0.25170 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.008 |
| RMSD bond angle | 1.627 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.8.0403) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 45.830 | 45.830 | 2.620 |
| High resolution limit [Å] | 2.550 | 11.400 | 2.550 |
| Rmerge | 0.227 | 0.036 | 5.252 |
| Rmeas | 0.230 | 0.037 | 5.319 |
| Total number of observations | 576555 | ||
| Number of reflections | 15094 | 222 | 1087 |
| <I/σ(I)> | 18.26 | 66.13 | 0.94 |
| Completeness [%] | 100.0 | 97.4 | 100 |
| Redundancy | 38.198 | 27.995 | 40.304 |
| CC(1/2) | 0.999 | 1.000 | 0.371 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 7 | 293 | protein in 25mM Tris/HCl pH 7.5 100mM NaCl, see also PMID 27658368 |






