5P8B
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 344
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.3 |
| Synchrotron site | BESSY |
| Beamline | 14.3 |
| Temperature [K] | 100 |
| Detector technology | CCD |
| Collection date | 2014-01-22 |
| Detector | MAR CCD 165 mm |
| Wavelength(s) | 0.8944 |
| Spacegroup name | P 1 21 1 |
| Unit cell lengths | 45.290, 72.986, 52.770 |
| Unit cell angles | 90.00, 109.46, 90.00 |
Refinement procedure
| Resolution | 22.268 - 1.548 |
| R-factor | 0.1491 |
| Rwork | 0.146 |
| R-free | 0.19900 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.008 |
| RMSD bond angle | 1.114 |
| Data reduction software | HKL-2000 |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 30.000 | 30.000 | 1.580 |
| High resolution limit [Å] | 1.550 | 4.200 | 1.550 |
| Rmerge | 0.062 | 0.018 | 0.422 |
| Total number of observations | 95741 | ||
| Number of reflections | 38417 | ||
| <I/σ(I)> | 9.1 | ||
| Completeness [%] | 81.8 | 74.1 | 69.1 |
| Redundancy | 2.5 | 2.8 | 2.4 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 344 with the SMILES code CCN1C=C(C=N1)C1=NC2=CC=CC=C2N1 |






