5P7C
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 309
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.3 |
| Synchrotron site | BESSY |
| Beamline | 14.3 |
| Temperature [K] | 100 |
| Detector technology | CCD |
| Collection date | 2014-01-22 |
| Detector | MAR CCD 165 mm |
| Wavelength(s) | 0.895 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 45.266, 72.742, 104.170 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 34.338 - 1.269 |
| R-factor | 0.1415 |
| Rwork | 0.140 |
| R-free | 0.16260 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.007 |
| RMSD bond angle | 1.168 |
| Data reduction software | XDS |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 45.266 | 1.350 | |
| High resolution limit [Å] | 1.270 | 3.790 | 1.270 |
| Rmerge | 0.069 | 0.021 | 0.612 |
| Rmeas | 0.074 | 0.023 | 0.654 |
| Total number of observations | 728161 | ||
| Number of reflections | 91311 | 3683 | 14377 |
| <I/σ(I)> | 20.28 | 67.42 | 3.34 |
| Completeness [%] | 99.6 | 99.7 | 98.2 |
| Redundancy | 7.974 | ||
| CC(1/2) | 0.999 | 0.999 | 0.869 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 309 with the SMILES code ClC1=CC=C(C=C1)S(=O)(=O)N1C=CC=CC1=O |






