5P5D
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 238
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.1 |
| Synchrotron site | BESSY |
| Beamline | 14.1 |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2013-04-04 |
| Detector | DECTRIS PILATUS 6M |
| Wavelength(s) | 0.918409 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 45.234, 72.616, 104.022 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 42.284 - 1.579 |
| R-factor | 0.1494 |
| Rwork | 0.147 |
| R-free | 0.18700 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.009 |
| RMSD bond angle | 1.156 |
| Data reduction software | XDS |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 45.234 | 1.680 | |
| High resolution limit [Å] | 1.580 | 4.710 | 1.580 |
| Rmerge | 0.102 | 0.037 | 0.523 |
| Rmeas | 0.110 | 0.040 | 0.565 |
| Total number of observations | 340512 | ||
| Number of reflections | 47742 | 1961 | 7593 |
| <I/σ(I)> | 16.07 | 42.33 | 3.72 |
| Completeness [%] | 99.8 | 99.4 | 99.4 |
| Redundancy | 7.132 | ||
| CC(1/2) | 0.998 | 0.999 | 0.894 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 238 with the SMILES code [O-][N+](=O)C1=CC=C(S1)C(=O)NC1CC1 |






