5P0E
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 61
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.3 |
| Synchrotron site | BESSY |
| Beamline | 14.3 |
| Temperature [K] | 100 |
| Detector technology | CCD |
| Collection date | 2015-07-17 |
| Detector | MAR CCD 165 mm |
| Wavelength(s) | 0.895 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 45.078, 72.364, 104.077 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 41.365 - 1.799 |
| R-factor | 0.1437 |
| Rwork | 0.141 |
| R-free | 0.19910 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.009 |
| RMSD bond angle | 1.123 |
| Data reduction software | XDS |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 45.078 | 1.910 | |
| High resolution limit [Å] | 1.800 | 5.360 | 1.800 |
| Rmerge | 0.113 | 0.040 | 0.528 |
| Rmeas | 0.120 | 0.043 | 0.563 |
| Total number of observations | 263595 | ||
| Number of reflections | 32186 | 1357 | 5041 |
| <I/σ(I)> | 17.28 | 39.9 | 4.7 |
| Completeness [%] | 99.5 | 99.7 | 98.7 |
| Redundancy | 8.189 | ||
| CC(1/2) | 0.998 | 0.999 | 0.915 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 61 with the SMILES code CCOC(=O)C1=C(C)C(Br)=C(C)N1 |






