5OYR
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 2
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.1 |
| Synchrotron site | BESSY |
| Beamline | 14.1 |
| Temperature [K] | 100 |
| Detector technology | CCD |
| Collection date | 2012-09-04 |
| Detector | MARMOSAIC 225 mm CCD |
| Wavelength(s) | 0.91841 |
| Spacegroup name | P 1 21 1 |
| Unit cell lengths | 45.294, 72.702, 52.451 |
| Unit cell angles | 90.00, 108.62, 90.00 |
Refinement procedure
| Resolution | 42.923 - 1.488 |
| R-factor | 0.1321 |
| Rwork | 0.131 |
| R-free | 0.16010 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.007 |
| RMSD bond angle | 1.201 |
| Data reduction software | XDS |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 42.923 | 1.580 | |
| High resolution limit [Å] | 1.490 | 4.440 | 1.490 |
| Rmerge | 0.050 | 0.020 | 0.378 |
| Rmeas | 0.057 | 0.023 | 0.436 |
| Total number of observations | 219157 | ||
| Number of reflections | 52628 | 2029 | 8354 |
| <I/σ(I)> | 19.32 | 54.22 | 3.6 |
| Completeness [%] | 99.4 | 99.1 | 97.7 |
| Redundancy | 4.164 | ||
| CC(1/2) | 0.999 | 0.999 | 0.881 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 2 with the SMILES code COC1=CC=C(\C(C)=N\O)C(OC)=C1 |






