VA

?

Summary

Name:(Z)-OCTADEC-11-ENYL ACETATE
Formula:C20 H38 O2
Formal charge:0
Molecular weight:310.515 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(11Z)-octadec-11-en-1-yl acetate
OpenEye OEToolkits1.5.0[(Z)-octadec-11-enyl] ethanoate

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(OCCCCCCCCCC\C=C/CCCCCC)C
SMILES_CANONICALCACTVS3.341CCCCCC\C=C/CCCCCCCCCCOC(C)=O
SMILESCACTVS3.341CCCCCCC=CCCCCCCCCCCOC(C)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0CCCCCC\C=C/CCCCCCCCCCOC(=O)C
SMILESOpenEye OEToolkits1.5.0CCCCCCC=CCCCCCCCCCCOC(=O)C
InChIInChI1.03InChI=1S/C20H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h8-9H,3-7,10-19H2,1-2H3/b9-8-
InChIKeyInChI1.03QSZKEDWVAOAFQY-HJWRWDBZSA-N
169436
PDB entries from 2020-09-30