T7S

?

Summary

Name:1-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethan-1-one
Formula:C13 H22 N2 O2
Formal charge:0
Molecular weight:238.326 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
ACDLabs12.011-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethan-1-one
OpenEye OEToolkits2.0.71-(4-piperidin-1-ylcarbonylpiperidin-1-yl)ethanone

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01N1(CCCCC1)C(C2CCN(CC2)C(C)=O)=O
InChIInChI1.03InChI=1S/C13H22N2O2/c1-11(16)14-9-5-12(6-10-14)13(17)15-7-3-2-4-8-15/h12H,2-10H2,1H3
InChIKeyInChI1.03VFXWKIZCOQQJGS-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CC(=O)N1CCC(CC1)C(=O)N2CCCCC2
SMILESCACTVS3.385CC(=O)N1CCC(CC1)C(=O)N2CCCCC2
SMILES_CANONICALOpenEye OEToolkits2.0.7CC(=O)N1CCC(CC1)C(=O)N2CCCCC2
SMILESOpenEye OEToolkits2.0.7CC(=O)N1CCC(CC1)C(=O)N2CCCCC2