T7G

?

Summary

Name:1-acetyl-N-(2-hydroxyphenyl)piperidine-4-carboxamide
Formula:C14 H18 N2 O3
Formal charge:0
Molecular weight:262.304 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
ACDLabs12.011-acetyl-N-(2-hydroxyphenyl)piperidine-4-carboxamide
OpenEye OEToolkits2.0.71-ethanoyl-~{N}-(2-hydroxyphenyl)piperidine-4-carboxamide

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01N2(CCC(C(Nc1ccccc1O)=O)CC2)C(C)=O
InChIInChI1.03InChI=1S/C14H18N2O3/c1-10(17)16-8-6-11(7-9-16)14(19)15-12-4-2-3-5-13(12)18/h2-5,11,18H,6-9H2,1H3,(H,15,19)
InChIKeyInChI1.03YKBMCZDLJSTFOC-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CC(=O)N1CCC(CC1)C(=O)Nc2ccccc2O
SMILESCACTVS3.385CC(=O)N1CCC(CC1)C(=O)Nc2ccccc2O
SMILES_CANONICALOpenEye OEToolkits2.0.7CC(=O)N1CCC(CC1)C(=O)Nc2ccccc2O
SMILESOpenEye OEToolkits2.0.7CC(=O)N1CCC(CC1)C(=O)Nc2ccccc2O