SZY

?

Summary

Name:N-(4-methylpyridin-3-yl)acetamide
Formula:C8 H10 N2 O
Formal charge:0
Molecular weight:150.178 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
ACDLabs12.01N-(4-methylpyridin-3-yl)acetamide
OpenEye OEToolkits2.0.7~{N}-(4-methylpyridin-3-yl)ethanamide

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01c1(ccncc1NC(C)=O)C
InChIInChI1.03InChI=1S/C8H10N2O/c1-6-3-4-9-5-8(6)10-7(2)11/h3-5H,1-2H3,(H,10,11)
InChIKeyInChI1.03WRPYDRDMRXJIJA-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CC(=O)Nc1cnccc1C
SMILESCACTVS3.385CC(=O)Nc1cnccc1C
SMILES_CANONICALOpenEye OEToolkits2.0.7Cc1ccncc1NC(=O)C
SMILESOpenEye OEToolkits2.0.7Cc1ccncc1NC(=O)C
170172
PDB entries from 2020-10-21