SH8

?

Summary

Name:6-methyl-2-oxidanylidene-chromene-3-carboxylic acid
Formula:C11 H8 O4
Formal charge:0
Molecular weight:204.179 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.76-methyl-2-oxidanylidene-chromene-3-carboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C11H8O4/c1-6-2-3-9-7(4-6)5-8(10(12)13)11(14)15-9/h2-5H,1H3,(H,12,13)
InChIKeyInChI1.03FJICLQQBBFWGMZ-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385Cc1ccc2OC(=O)C(=Cc2c1)C(O)=O
SMILESCACTVS3.385Cc1ccc2OC(=O)C(=Cc2c1)C(O)=O
SMILES_CANONICALOpenEye OEToolkits2.0.7Cc1ccc2c(c1)C=C(C(=O)O2)C(=O)O
SMILESOpenEye OEToolkits2.0.7Cc1ccc2c(c1)C=C(C(=O)O2)C(=O)O