SBT

?

Summary

Name:2-BUTANOL
Formula:C4 H10 O
Formal charge:0
Molecular weight:74.122 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(2S)-butan-2-ol
OpenEye OEToolkits1.5.0(2S)-butan-2-ol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04OC(C)CC
SMILES_CANONICALCACTVS3.341CC[C@H](C)O
SMILESCACTVS3.341CC[CH](C)O
SMILES_CANONICALOpenEye OEToolkits1.5.0CC[C@H](C)O
SMILESOpenEye OEToolkits1.5.0CCC(C)O
InChIInChI1.03InChI=1S/C4H10O/c1-3-4(2)5/h4-5H,3H2,1-2H3/t4-/m0/s1
InChIKeyInChI1.03BTANRVKWQNVYAZ-BYPYZUCNSA-N