PHE

?

Summary

Name:PHENYLALANINE
Formula:C9 H11 N O2
Formal charge:0
Molecular weight:165.189 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs10.04L-phenylalanine
OpenEye OEToolkits1.5.0(2S)-2-amino-3-phenyl-propanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(N)Cc1ccccc1
SMILES_CANONICALCACTVS3.341N[C@@H](Cc1ccccc1)C(O)=O
SMILESCACTVS3.341N[CH](Cc1ccccc1)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0c1ccc(cc1)C[C@@H](C(=O)O)N
SMILESOpenEye OEToolkits1.5.0c1ccc(cc1)CC(C(=O)O)N
InChIInChI1.03InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1
InChIKeyInChI1.03COLNVLDHVKWLRT-QMMMGPOBSA-N