ORN

?

Summary

Name:L-ornithine
Formula:C5 H12 N2 O2
Formal charge:0
Molecular weight:132.161 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs12.01L-ornithine
OpenEye OEToolkits1.7.6(2S)-2,5-bis(azanyl)pentanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C(N)CCCN
InChIInChI1.03InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1
InChIKeyInChI1.03AHLPHDHHMVZTML-BYPYZUCNSA-N
SMILES_CANONICALCACTVS3.370NCCC[C@H](N)C(O)=O
SMILESCACTVS3.370NCCC[CH](N)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.6C(C[C@@H](C(=O)O)N)CN
SMILESOpenEye OEToolkits1.7.6C(CC(C(=O)O)N)CN