NZZ

?

Summary

Name:(2Z)-3,7-dimethylocta-2,6-dien-1-ol
Synonyms:nerol
Formula:C10 H18 O
Formal charge:0
Molecular weight:154.249 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(2Z)-3,7-dimethylocta-2,6-dien-1-ol
OpenEye OEToolkits2.0.7(2~{Z})-3,7-dimethylocta-2,6-dien-1-ol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01C/C(C)=C/CCC(C)=[C@H]CO
InChIInChI1.03InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7-
InChIKeyInChI1.03GLZPCOQZEFWAFX-YFHOEESVSA-N
SMILES_CANONICALCACTVS3.385CC(C)=CCC\C(C)=C/CO
SMILESCACTVS3.385CC(C)=CCCC(C)=CCO
SMILES_CANONICALOpenEye OEToolkits2.0.7CC(=CCC/C(=C\CO)/C)C
SMILESOpenEye OEToolkits2.0.7CC(=CCCC(=CCO)C)C