NLZ

?

Summary

Name:2,4-bis(oxidanyl)benzamide
Formula:C7 H7 N O3
Formal charge:0
Molecular weight:153.135 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.72,4-bis(oxidanyl)benzamide

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C7H7NO3/c8-7(11)5-2-1-4(9)3-6(5)10/h1-3,9-10H,(H2,8,11)
InChIKeyInChI1.03IIUJCQYKTGNRHH-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385NC(=O)c1ccc(O)cc1O
SMILESCACTVS3.385NC(=O)c1ccc(O)cc1O
SMILES_CANONICALOpenEye OEToolkits2.0.7c1cc(c(cc1O)O)C(=O)N
SMILESOpenEye OEToolkits2.0.7c1cc(c(cc1O)O)C(=O)N
170172
PDB entries from 2020-10-21