NL8

?

Summary

Name:~{N}-(4-aminocarbonylphenyl)-~{N}-methyl-2,4-bis(oxidanyl)benzamide
Formula:C15 H14 N2 O4
Formal charge:0
Molecular weight:286.283 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.7~{N}-(4-aminocarbonylphenyl)-~{N}-methyl-2,4-bis(oxidanyl)benzamide

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C15H14N2O4/c1-17(10-4-2-9(3-5-10)14(16)20)15(21)12-7-6-11(18)8-13(12)19/h2-8,18-19H,1H3,(H2,16,20)
InChIKeyInChI1.03BCONCFRKDGKCRJ-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CN(C(=O)c1ccc(O)cc1O)c2ccc(cc2)C(N)=O
SMILESCACTVS3.385CN(C(=O)c1ccc(O)cc1O)c2ccc(cc2)C(N)=O
SMILES_CANONICALOpenEye OEToolkits2.0.7CN(c1ccc(cc1)C(=O)N)C(=O)c2ccc(cc2O)O
SMILESOpenEye OEToolkits2.0.7CN(c1ccc(cc1)C(=O)N)C(=O)c2ccc(cc2O)O
170172
PDB entries from 2020-10-21