N08

?

Summary

Name:~{N}-[2-(4-fluorophenyl)ethyl]furan-2-carboxamide
Formula:C13 H12 F N O2
Formal charge:0
Molecular weight:233.238 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.7~{N}-[2-(4-fluorophenyl)ethyl]furan-2-carboxamide

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C13H12FNO2/c14-11-5-3-10(4-6-11)7-8-15-13(16)12-2-1-9-17-12/h1-6,9H,7-8H2,(H,15,16)
InChIKeyInChI1.03GSMVTQDRELNXRQ-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385Fc1ccc(CCNC(=O)c2occc2)cc1
SMILESCACTVS3.385Fc1ccc(CCNC(=O)c2occc2)cc1
SMILES_CANONICALOpenEye OEToolkits2.0.7c1cc(oc1)C(=O)NCCc2ccc(cc2)F
SMILESOpenEye OEToolkits2.0.7c1cc(oc1)C(=O)NCCc2ccc(cc2)F