MF8

?

Summary

Name:Metformin
Synonyms:N,N-Dimethylimidodicarbonimidic diamide
Formula:C4 H11 N5
Formal charge:0
Molecular weight:129.164 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits1.7.63-carbamimidoyl-1,1-dimethyl-guanidine

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C4H11N5/c1-9(2)4(7)8-3(5)6/h1-2H3,(H5,5,6,7,8)
InChIKeyInChI1.03XZWYZXLIPXDOLR-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CN(C)C(=N)NC(N)=N
SMILESCACTVS3.385CN(C)C(=N)NC(N)=N
SMILES_CANONICALOpenEye OEToolkits1.7.6[H]/N=C(/N)\N/C(=N\[H])/N(C)C
SMILESOpenEye OEToolkits1.7.6CN(C)C(=N)NC(=N)N
167327
PDB entries from 2020-08-05