MB3

?

Summary

Name:1-methylpyrrolidin-2-one
Formula:C5 H9 N O
Formal charge:0
Molecular weight:99.131 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.011-methylpyrrolidin-2-one
OpenEye OEToolkits1.7.01-methylpyrrolidin-2-one

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C1N(C)CCC1
SMILES_CANONICALCACTVS3.370CN1CCCC1=O
SMILESCACTVS3.370CN1CCCC1=O
SMILES_CANONICALOpenEye OEToolkits1.7.0CN1CCCC1=O
SMILESOpenEye OEToolkits1.7.0CN1CCCC1=O
InChIInChI1.03InChI=1S/C5H9NO/c1-6-4-2-3-5(6)7/h2-4H2,1H3
InChIKeyInChI1.03SECXISVLQFMRJM-UHFFFAOYSA-N