LNJ

?

Summary

Name:4-{4-[(4-methoxyphenyl)methyl]phenyl}-1,3-thiazol-2-amine
Formula:C17 H16 N2 O S
Formal charge:0
Molecular weight:296.387 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.014-{4-[(4-methoxyphenyl)methyl]phenyl}-1,3-thiazol-2-amine
OpenEye OEToolkits2.0.74-[4-[(4-methoxyphenyl)methyl]phenyl]-1,3-thiazol-2-amine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01c2cc(c1nc(sc1)N)ccc2Cc3ccc(cc3)OC
InChIInChI1.03InChI=1S/C17H16N2OS/c1-20-15-8-4-13(5-9-15)10-12-2-6-14(7-3-12)16-11-21-17(18)19-16/h2-9,11H,10H2,1H3,(H2,18,19)
InChIKeyInChI1.03GGCCOFFVKJCRKJ-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385COc1ccc(Cc2ccc(cc2)c3csc(N)n3)cc1
SMILESCACTVS3.385COc1ccc(Cc2ccc(cc2)c3csc(N)n3)cc1
SMILES_CANONICALOpenEye OEToolkits2.0.7COc1ccc(cc1)Cc2ccc(cc2)c3csc(n3)N
SMILESOpenEye OEToolkits2.0.7COc1ccc(cc1)Cc2ccc(cc2)c3csc(n3)N