KJY

?

Summary

Name:2,4-dihydroxy-3,6-dimethylbenzaldehyde
Formula:C9 H10 O3
Formal charge:0
Molecular weight:166.174 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.012,4-dihydroxy-3,6-dimethylbenzaldehyde
OpenEye OEToolkits2.0.63,6-dimethyl-2,4-bis(oxidanyl)benzaldehyde

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01Cc1cc(c(c(O)c1C=O)C)O
InChIInChI1.03InChI=1S/C9H10O3/c1-5-3-8(11)6(2)9(12)7(5)4-10/h3-4,11-12H,1-2H3
InChIKeyInChI1.03XOAAGSCMGLMPKG-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385Cc1cc(O)c(C)c(O)c1C=O
SMILESCACTVS3.385Cc1cc(O)c(C)c(O)c1C=O
SMILES_CANONICALOpenEye OEToolkits2.0.6Cc1cc(c(c(c1C=O)O)C)O
SMILESOpenEye OEToolkits2.0.6Cc1cc(c(c(c1C=O)O)C)O