K42

?

Summary

Name:4-(2-azanylethoxy)phenol
Formula:C8 H11 N O2
Formal charge:0
Molecular weight:153.178 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.74-(2-azanylethoxy)phenol

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C8H11NO2/c9-5-6-11-8-3-1-7(10)2-4-8/h1-4,10H,5-6,9H2
InChIKeyInChI1.03QSDOKFGRSJQNMX-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385NCCOc1ccc(O)cc1
SMILESCACTVS3.385NCCOc1ccc(O)cc1
SMILES_CANONICALOpenEye OEToolkits2.0.7c1cc(ccc1O)OCCN
SMILESOpenEye OEToolkits2.0.7c1cc(ccc1O)OCCN