K3Q

?

Summary

Name:3,6-O-dimethyl-D-glucose
Formula:C8 H16 O6
Formal charge:0
Molecular weight:208.209 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.7(2~{R},3~{R},4~{S},5~{R},6~{R})-4-methoxy-6-(methoxymethyl)oxane-2,3,5-triol

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C8H16O6/c1-12-3-4-5(9)7(13-2)6(10)8(11)14-4/h4-11H,3H2,1-2H3/t4-,5-,6-,7+,8-/m1/s1
InChIKeyInChI1.03HXTJYTSBXOATMS-UIAUGNHASA-N
SMILES_CANONICALCACTVS3.385COC[C@H]1O[C@@H](O)[C@H](O)[C@@H](OC)[C@@H]1O
SMILESCACTVS3.385COC[CH]1O[CH](O)[CH](O)[CH](OC)[CH]1O
SMILES_CANONICALOpenEye OEToolkits2.0.7COC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)O)OC)O
SMILESOpenEye OEToolkits2.0.7COCC1C(C(C(C(O1)O)O)OC)O