JGE

?

Summary

Name:(R)-Ketoprofen
Formula:C16 H14 O3
Formal charge:0
Molecular weight:254.281 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.7(2~{R})-2-[3-(phenylcarbonyl)phenyl]propanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/t11-/m1/s1
InChIKeyInChI1.03DKYWVDODHFEZIM-LLVKDONJSA-N
SMILES_CANONICALCACTVS3.385C[C@@H](C(O)=O)c1cccc(c1)C(=O)c2ccccc2
SMILESCACTVS3.385C[CH](C(O)=O)c1cccc(c1)C(=O)c2ccccc2
SMILES_CANONICALOpenEye OEToolkits2.0.7C[C@H](c1cccc(c1)C(=O)c2ccccc2)C(=O)O
SMILESOpenEye OEToolkits2.0.7CC(c1cccc(c1)C(=O)c2ccccc2)C(=O)O