IPA

?

Summary

Name:ISOPROPYL ALCOHOL
Synonyms:2-PROPANOL
Formula:C3 H8 O
Formal charge:0
Molecular weight:60.095 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs11.02propan-2-ol
OpenEye OEToolkits1.6.1propan-2-ol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs11.02OC(C)C
SMILES_CANONICALCACTVS3.352CC(C)O
SMILESCACTVS3.352CC(C)O
SMILES_CANONICALOpenEye OEToolkits1.7.0CC(C)O
SMILESOpenEye OEToolkits1.7.0CC(C)O
InChIInChI1.03InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
InChIKeyInChI1.03KFZMGEQAYNKOFK-UHFFFAOYSA-N
170172
PDB entries from 2020-10-21