HLG

?

Summary

Name:N-{3-[(4-aminobutyl)amino]propyl}acetamide
Formula:C9 H21 N3 O
Formal charge:0
Molecular weight:187.283 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01N-{3-[(4-aminobutyl)amino]propyl}acetamide
OpenEye OEToolkits2.0.6~{N}-[3-(4-azanylbutylamino)propyl]ethanamide

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01CC(NCCCNCCCCN)=O
InChIInChI1.03InChI=1S/C9H21N3O/c1-9(13)12-8-4-7-11-6-3-2-5-10/h11H,2-8,10H2,1H3,(H,12,13)
InChIKeyInChI1.03MQTAVJHICJWXBR-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CC(=O)NCCCNCCCCN
SMILESCACTVS3.385CC(=O)NCCCNCCCCN
SMILES_CANONICALOpenEye OEToolkits2.0.6CC(=O)NCCCNCCCCN
SMILESOpenEye OEToolkits2.0.6CC(=O)NCCCNCCCCN