GNG

?

Summary

Name:2'-DEOXY-GUANOSINE
Formula:C10 H13 N5 O4
Formal charge:0
Molecular weight:267.241 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.042'-deoxyguanosine
OpenEye OEToolkits1.5.02-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C3N=C(N)Nc1c3ncn1C2OC(C(O)C2)CO
SMILES_CANONICALCACTVS3.341NC1=NC(=O)c2ncn([C@H]3C[C@H](O)[C@@H](CO)O3)c2N1
SMILESCACTVS3.341NC1=NC(=O)c2ncn([CH]3C[CH](O)[CH](CO)O3)c2N1
SMILES_CANONICALOpenEye OEToolkits1.5.0c1nc2c(n1[C@H]3C[C@@H]([C@H](O3)CO)O)NC(=NC2=O)N
SMILESOpenEye OEToolkits1.5.0c1nc2c(n1C3CC(C(O3)CO)O)NC(=NC2=O)N
InChIInChI1.03InChI=1S/C10H13N5O4/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,6+/m0/s1
InChIKeyInChI1.03YKBGVTZYEHREMT-KVQBGUIXSA-N