GMP

?

Summary

Name:GUANOSINE
Formula:C10 H13 N5 O5
Formal charge:0
Molecular weight:283.241 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04guanosine
OpenEye OEToolkits1.5.02-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C1c2ncn(c2N=C(N)N1)C3OC(C(O)C3O)CO
InChIInChI1.03InChI=1S/C10H13N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19)/t3-,5-,6-,9-/m1/s1
InChIKeyInChI1.03NYHBQMYGNKIUIF-UUOKFMHZSA-N
SMILES_CANONICALCACTVS3.385NC1=Nc2n(cnc2C(=O)N1)[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O
SMILESCACTVS3.385NC1=Nc2n(cnc2C(=O)N1)[CH]3O[CH](CO)[CH](O)[CH]3O
SMILES_CANONICALOpenEye OEToolkits1.7.5c1nc2c(n1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=C(NC2=O)N
SMILESOpenEye OEToolkits1.7.5c1nc2c(n1C3C(C(C(O3)CO)O)O)N=C(NC2=O)N
171588
PDB entries from 2020-11-25