GMH

?

Summary

Name:L-glycero-alpha-D-manno-heptopyranose
Synonyms:L-glycero-alpha-D-manno-heptose
L-glycero-D-manno-heptose; L-glycero-manno-heptose; L-GLYCERO-D-MANNO-HEPTOPYRANOSE
Formula:C7 H14 O7
Formal charge:0
Molecular weight:210.182 Da
Component type:D-saccharide, alpha linking

Chemical Identifiers

ProgramVersionName
ACDLabs10.04L-glycero-alpha-D-manno-heptopyranose
OpenEye OEToolkits1.5.0(2S,3S,4S,5S,6R)-6-[(1S)-1,2-dihydroxyethyl]oxane-2,3,4,5-tetrol
GMML1.0LDmanHep
PDB-CARE1.0L-gro-a-D-manHepp

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04OC1C(O)C(OC(O)C1O)C(O)CO
SMILES_CANONICALCACTVS3.341OC[C@H](O)[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O
SMILESCACTVS3.341OC[CH](O)[CH]1O[CH](O)[CH](O)[CH](O)[CH]1O
SMILES_CANONICALOpenEye OEToolkits1.5.0C([C@@H]([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)O)O)O)O)O)O
SMILESOpenEye OEToolkits1.5.0C(C(C1C(C(C(C(O1)O)O)O)O)O)O
InChIInChI1.03InChI=1S/C7H14O7/c8-1-2(9)6-4(11)3(10)5(12)7(13)14-6/h2-13H,1H2/t2-,3-,4-,5-,6+,7-/m0/s1
InChIKeyInChI1.03BGWQRWREUZVRGI-QQABCQGCSA-N
169117
PDB entries from 2020-09-23