GGL

?

Summary

Name:GAMMA-L-GLUTAMIC ACID
Synonyms:L-GLUTAMIC ACID
Formula:C5 H9 N O4
Formal charge:0
Molecular weight:147.129 Da
Component type:L-gamma-peptide, C-delta linking

Chemical Identifiers

ProgramVersionName
ACDLabs12.01L-glutamic acid
OpenEye OEToolkits1.7.2(2S)-2-azanylpentanedioic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C(N)CCC(=O)O
SMILES_CANONICALCACTVS3.370N[C@@H](CCC(O)=O)C(O)=O
SMILESCACTVS3.370N[CH](CCC(O)=O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.2C(CC(=O)O)[C@@H](C(=O)O)N
SMILESOpenEye OEToolkits1.7.2C(CC(=O)O)C(C(=O)O)N
InChIInChI1.03InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1
InChIKeyInChI1.03WHUUTDBJXJRKMK-VKHMYHEASA-N
169963
PDB entries from 2020-10-14