GCN

?

Summary

Name:2-amino-2,3-dideoxy-alpha-D-glucoyranose
Synonyms:3-DEOXY-D-GLUCOSAMINE
3-deoxy-alpha-D-glucosamine
Formula:C6 H13 N O4
Formal charge:0
Molecular weight:163.172 Da
Component type:D-saccharide, alpha linking

Chemical Identifiers

ProgramVersionName
ACDLabs10.042-amino-2,3-dideoxy-alpha-D-ribo-hexopyranose
OpenEye OEToolkits1.5.0(2S,3R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,5-diol
PDB-CARE1.0a-D-3-deoxy-GlcpN

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04OC1C(OC(O)C(N)C1)CO
SMILES_CANONICALCACTVS3.341N[C@@H]1C[C@H](O)[C@@H](CO)O[C@@H]1O
SMILESCACTVS3.341N[CH]1C[CH](O)[CH](CO)O[CH]1O
SMILES_CANONICALOpenEye OEToolkits1.5.0C1[C@H]([C@H](O[C@@H]([C@H]1O)CO)O)N
SMILESOpenEye OEToolkits1.5.0C1C(C(OC(C1O)CO)O)N
InChIInChI1.03InChI=1S/C6H13NO4/c7-3-1-4(9)5(2-8)11-6(3)10/h3-6,8-10H,1-2,7H2/t3-,4+,5-,6+/m1/s1
InChIKeyInChI1.03SNDZDGQLFKEBLF-MOJAZDJTSA-N
168889
PDB entries from 2020-09-16