FUZ

?

Summary

Name:2-[(furan-2-ylmethyl)amino]benzoic acid
Formula:C12 H11 N O3
Formal charge:0
Molecular weight:217.221 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs11.022-[(furan-2-ylmethyl)amino]benzoic acid
OpenEye OEToolkits1.6.12-(furan-2-ylmethylamino)benzoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs11.02O=C(O)c2c(NCc1occc1)cccc2
SMILES_CANONICALCACTVS3.352OC(=O)c1ccccc1NCc2occc2
SMILESCACTVS3.352OC(=O)c1ccccc1NCc2occc2
SMILES_CANONICALOpenEye OEToolkits1.7.0c1ccc(c(c1)C(=O)O)NCc2ccco2
SMILESOpenEye OEToolkits1.7.0c1ccc(c(c1)C(=O)O)NCc2ccco2
InChIInChI1.03InChI=1S/C12H11NO3/c14-12(15)10-5-1-2-6-11(10)13-8-9-4-3-7-16-9/h1-7,13H,8H2,(H,14,15)
InChIKeyInChI1.03CKOPWCOBXHDAOZ-UHFFFAOYSA-N