FT6

?

Summary

Name:6-FLUORO-L-TRYPTOPHAN
Synonyms:(S)-2-AMINO-3-(6-FLUORO-1H-INDOL-3-YL)PROPANOIC ACID
Formula:C11 H11 F N2 O2
Formal charge:0
Molecular weight:222.216 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs10.046-fluoro-L-tryptophan
OpenEye OEToolkits1.5.0(2S)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(N)Cc2c1ccc(F)cc1nc2
SMILES_CANONICALCACTVS3.341N[C@@H](Cc1c[nH]c2cc(F)ccc12)C(O)=O
SMILESCACTVS3.341N[CH](Cc1c[nH]c2cc(F)ccc12)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0c1cc2c(cc1F)[nH]cc2C[C@@H](C(=O)O)N
SMILESOpenEye OEToolkits1.5.0c1cc2c(cc1F)[nH]cc2CC(C(=O)O)N
InChIInChI1.03InChI=1S/C11H11FN2O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m0/s1
InChIKeyInChI1.03YMEXGEAJNZRQEH-VIFPVBQESA-N