FT2

?

Summary

Name:5-(chloromethyl)-2-(2,4-dichlorophenoxy)phenol
Formula:C13 H9 Cl3 O2
Formal charge:0
Molecular weight:303.568 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits1.6.15-(chloromethyl)-2-(2,4-dichlorophenoxy)phenol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILES_CANONICALCACTVS3.352Oc1cc(CCl)ccc1Oc2ccc(Cl)cc2Cl
SMILESCACTVS3.352Oc1cc(CCl)ccc1Oc2ccc(Cl)cc2Cl
SMILES_CANONICALOpenEye OEToolkits1.7.0c1cc(c(cc1CCl)O)Oc2ccc(cc2Cl)Cl
SMILESOpenEye OEToolkits1.7.0c1cc(c(cc1CCl)O)Oc2ccc(cc2Cl)Cl
InChIInChI1.03InChI=1S/C13H9Cl3O2/c14-7-8-1-3-13(11(17)5-8)18-12-4-2-9(15)6-10(12)16/h1-6,17H,7H2
InChIKeyInChI1.03XVCALTYAVXDHNO-UHFFFAOYSA-N