FNN

?

Summary

Name:3-fluoro-4-nitrophenol
Formula:C6 H4 F N O3
Formal charge:0
Molecular weight:157.099 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.013-fluoro-4-nitrophenol
OpenEye OEToolkits1.7.23-fluoranyl-4-nitro-phenol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01Fc1c([N+]([O-])=O)ccc(O)c1
InChIInChI1.03InChI=1S/C6H4FNO3/c7-5-3-4(9)1-2-6(5)8(10)11/h1-3,9H
InChIKeyInChI1.03CSSGKHVRDGATJL-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370Oc1ccc(c(F)c1)[N+]([O-])=O
SMILESCACTVS3.370Oc1ccc(c(F)c1)[N+]([O-])=O
SMILES_CANONICALOpenEye OEToolkits1.7.2c1cc(c(cc1O)F)[N+](=O)[O-]
SMILESOpenEye OEToolkits1.7.2c1cc(c(cc1O)F)[N+](=O)[O-]
167132
PDB entries from 2020-07-29