FMF

?

Summary

Name:2-DEOXY-2-FLUOROHEXOPYRANOSYL FLUORIDE
Synonyms:2-DEOXY-2-FLUORO-ALPHA-D-MANNOSYL FLUORIDE
Formula:C6 H10 F2 O4
Formal charge:0
Molecular weight:184.138 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.042-deoxy-2-fluoro-beta-D-mannopyranosyl fluoride
OpenEye OEToolkits1.5.0(2R,3S,4S,5S,6S)-5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04FC1C(O)C(O)C(OC1F)CO
SMILES_CANONICALCACTVS3.341OC[C@H]1O[C@@H](F)[C@@H](F)[C@@H](O)[C@@H]1O
SMILESCACTVS3.341OC[CH]1O[CH](F)[CH](F)[CH](O)[CH]1O
SMILES_CANONICALOpenEye OEToolkits1.5.0C([C@@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)F)F)O)O)O
SMILESOpenEye OEToolkits1.5.0C(C1C(C(C(C(O1)F)F)O)O)O
InChIInChI1.03InChI=1S/C6H10F2O4/c7-3-5(11)4(10)2(1-9)12-6(3)8/h2-6,9-11H,1H2/t2-,3+,4-,5-,6?/m1/s1
InChIKeyInChI1.03YZRDPODBASCWCK-CBPJZXOFSA-N