FLV

?

Summary

Name:FLAVIOLIN
Synonyms:2,5,7-TRIHYDROXYNAPHTHOQUINONE
Formula:C10 H6 O5
Formal charge:0
Molecular weight:206.152 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.042,5,7-trihydroxynaphthalene-1,4-dione
OpenEye OEToolkits1.5.02,5,7-trihydroxynaphthalene-1,4-dione

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C2c1c(O)cc(O)cc1C(=O)C(O)=C2
SMILES_CANONICALCACTVS3.341Oc1cc(O)c2C(=O)C=C(O)C(=O)c2c1
SMILESCACTVS3.341Oc1cc(O)c2C(=O)C=C(O)C(=O)c2c1
SMILES_CANONICALOpenEye OEToolkits1.5.0c1c(cc(c2c1C(=O)C(=CC2=O)O)O)O
SMILESOpenEye OEToolkits1.5.0c1c(cc(c2c1C(=O)C(=CC2=O)O)O)O
InChIInChI1.03InChI=1S/C10H6O5/c11-4-1-5-9(6(12)2-4)7(13)3-8(14)10(5)15/h1-3,11-12,14H
InChIKeyInChI1.03RROPNRTUMVVUED-UHFFFAOYSA-N