FFX

?

Summary

Name:(2R,3S,5R,6S)-2,6-DIFLUOROOXANE-3,4,5-TRIOL
Formula:C5 H8 F2 O4
Formal charge:0
Molecular weight:170.111 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(2R,3S,4s,5R,6S)-2,6-difluorotetrahydro-2H-pyran-3,4,5-triol (non-preferred name)
OpenEye OEToolkits1.6.1(2R,3S,5R,6S)-2,6-difluorooxane-3,4,5-triol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04FC1OC(F)C(O)C(O)C1O
SMILES_CANONICALCACTVS3.352O[C@@H]1[C@@H](O)[C@H](F)O[C@H](F)[C@H]1O
SMILESCACTVS3.352O[CH]1[CH](O)[CH](F)O[CH](F)[CH]1O
SMILES_CANONICALOpenEye OEToolkits1.6.1C1([C@H]([C@@H](O[C@@H]([C@H]1O)F)F)O)O
SMILESOpenEye OEToolkits1.6.1C1(C(C(OC(C1O)F)F)O)O
InChIInChI1.03InChI=1S/C5H8F2O4/c6-4-2(9)1(8)3(10)5(7)11-4/h1-5,8-10H/t1-,2-,3+,4-,5+
InChIKeyInChI1.03QCYATGUEQPTSRF-IYJRPRHRSA-N