F9D

?

Summary

Name:(2R)-2-aminopent-4-ynoic acid
Formula:C5 H7 N O2
Formal charge:0
Molecular weight:113.115 Da
Component type:D-peptide linking

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(2R)-2-aminopent-4-ynoic acid
OpenEye OEToolkits2.0.6(2~{R})-2-azanylpent-4-ynoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01C(=O)(O)C(N)CC#C
InChIInChI1.03InChI=1S/C5H7NO2/c1-2-3-4(6)5(7)8/h1,4H,3,6H2,(H,7,8)/t4-/m1/s1
InChIKeyInChI1.03DGYHPLMPMRKMPD-SCSAIBSYSA-N
SMILES_CANONICALCACTVS3.385N[C@H](CC#C)C(O)=O
SMILESCACTVS3.385N[CH](CC#C)C(O)=O
SMILES_CANONICALOpenEye OEToolkits2.0.6C#CC[C@H](C(=O)O)N
SMILESOpenEye OEToolkits2.0.6C#CCC(C(=O)O)N