F8F

?

Summary

Name:(2S,5S)-5-azanyl-3,4,6-tris(oxidanyl)oxane-2-carboxylic acid
Formula:C6 H11 N O6
Formal charge:0
Molecular weight:193.155 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.7(2~{S},5~{S})-5-azanyl-3,4,6-tris(oxidanyl)oxane-2-carboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C6H11NO6/c7-1-2(8)3(9)4(5(10)11)13-6(1)12/h1-4,6,8-9,12H,7H2,(H,10,11)/t1-,2-,3+,4-,6-/m0/s1
InChIKeyInChI1.03CRIPFXSBMSGPKB-WAXACMCWSA-N
SMILES_CANONICALCACTVS3.385N[C@@H]1[C@@H](O)O[C@@H]([C@H](O)[C@H]1O)C(O)=O
SMILESCACTVS3.385N[CH]1[CH](O)O[CH]([CH](O)[CH]1O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits2.0.7[C@@H]1(C(C([C@H](OC1O)C(=O)O)O)O)N
SMILESOpenEye OEToolkits2.0.7C1(C(C(C(OC1O)C(=O)O)O)O)N
171916
PDB entries from 2020-12-02