F6N

?

Summary

Name:2-(aminomethyl)-1,3-oxazole-4-carboxylic acid
Formula:C5 H6 N2 O3
Formal charge:0
Molecular weight:142.113 Da
Component type:peptide linking

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.62-(aminomethyl)-1,3-oxazole-4-carboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C5H6N2O3/c6-1-4-7-3(2-10-4)5(8)9/h2H,1,6H2,(H,8,9)
InChIKeyInChI1.03LUKSXHYAGIRPPQ-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385NCc1occ(n1)C(O)=O
SMILESCACTVS3.385NCc1occ(n1)C(O)=O
SMILES_CANONICALOpenEye OEToolkits2.0.6c1c(nc(o1)CN)C(=O)O
SMILESOpenEye OEToolkits2.0.6c1c(nc(o1)CN)C(=O)O