F40

?

Summary

Name:2-phenyl-3H-quinazolin-4-one
Formula:C14 H10 N2 O
Formal charge:0
Molecular weight:222.242 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
ACDLabs12.012-phenylquinazolin-4(3H)-one
OpenEye OEToolkits1.9.22-phenyl-3H-quinazolin-4-one

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C2c3ccccc3N=C(c1ccccc1)N2
InChIInChI1.03InChI=1S/C14H10N2O/c17-14-11-8-4-5-9-12(11)15-13(16-14)10-6-2-1-3-7-10/h1-9H,(H,15,16,17)
InChIKeyInChI1.03VDULOAUXSMYUMG-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385O=C1NC(=Nc2ccccc12)c3ccccc3
SMILESCACTVS3.385O=C1NC(=Nc2ccccc12)c3ccccc3
SMILES_CANONICALOpenEye OEToolkits1.9.2c1ccc(cc1)C2=Nc3ccccc3C(=O)N2
SMILESOpenEye OEToolkits1.9.2c1ccc(cc1)C2=Nc3ccccc3C(=O)N2