F0Z

?

Summary

Name:2-(1,4,5,6-tetrahydropyrimidin-2-yl)benzenethiol
Formula:C10 H12 N2 S
Formal charge:0
Molecular weight:192.281 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.62-(1,4,5,6-tetrahydropyrimidin-2-yl)benzenethiol

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C10H12N2S/c13-9-5-2-1-4-8(9)10-11-6-3-7-12-10/h1-2,4-5,13H,3,6-7H2,(H,11,12)
InChIKeyInChI1.03DUHDUYRXLGSMLQ-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385Sc1ccccc1C2=NCCCN2
SMILESCACTVS3.385Sc1ccccc1C2=NCCCN2
SMILES_CANONICALOpenEye OEToolkits2.0.6c1ccc(c(c1)C2=NCCCN2)S
SMILESOpenEye OEToolkits2.0.6c1ccc(c(c1)C2=NCCCN2)S